| Identification | |
| Name: | calcium sulphidoacetate |
| Synonyms: | calcium sulphidoacetate;Mercaptoacetic acid/calcium,(1:1) salt;Acetic acid, 2-mercapto-, calcium salt (1:1);Acetic acid, mercapto-, calcium salt (1:1);Einecs 249-881-5 |
| CAS: | 29820-13-1 |
| EINECS: | 249-881-5 |
| Molecular Formula: | C2H2CaO2S |
| Molecular Weight: | 130.17908 |
| InChI: | InChI=1/C2H4O2S.Ca/c3-2(4)1-5;/h5H,1H2,(H,3,4);/q;+2/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -16.5 deg C |
| Flash Point: | 99.8°C |
| Boiling Point: | 225.5°C at 760 mmHg |
| Solubility: | Miscible with water, alcohol, ether, chloroform, benzene and many other org solvents Miscible with water, ethanol, and ethyl ether; slightyl soluble in chloroform. Miscible with water, mono- and polyalcohols, ethers, ketones, esters, chlorinated hydrocarbons, and aromatic hydrocarbons, but not with aliphatic hydrocarbons. |
| Flash Point: | 99.8°C |
| Color: | Clear, colorless liquid Water-white liquid |
| Safety Data | |
 |
|
