| Identification | |
| Name: | Octyl-beta-D-glucopyranoside |
| Synonyms: | Glucopyranoside,octyl, b-D- (8CI);1-O-Octyl-b-D-glucopyranose;1-O-Octyl-b-D-glucopyranoside;1-O-n-Octyl-b-D-glucopyranoside;1-Octyl b-D-glucopyranoside;1-Octyl b-D-glucoside;1-n-Octyl b-D-glucopyranoside;BTB 11967;Octyl glucoside;Octyl b-D-glucoside;Octyl b-D-glycopyranoside;Octyl b-glucopyranoside;n-Octyl b-D-glucopyranoside;n-Octyl b-D-glucoside;b-D-Octyl glucoside;b-Octyl monoglucoside; |
| CAS: | 29836-26-8 |
| EINECS: | 249-887-8 |
| Molecular Formula: | C14H28O6 |
| Molecular Weight: | 292.37 |
| InChI: | InChI=1/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10-,11-,12+,13-,14-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.18 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | -27 ° (C=1, MeOH) |
| Alpha: | -32 º (C=5, WATER) |
| Water Solubility: | 3 g/10 mL |
| Solubility: | 3 g/10 mL |
| Appearance: | White solid. |
| Specification: |
beta-D-Glucopyranoside, octyl , its CAS NO. is 29836-26-8, the synonyms are Octyl-beta-D-glucoside ; 1-O-Octyl-beta-D-glucopyranoside . |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
