Identification |
Name: | Beta-D-Galactopyranoside, octyl |
Synonyms: | 1-O-Octyl-b-D-galactopyranoside;Galactopyranoside,octyl, b-D- (6CI);Octyl b-D-galactopyranoside;Octyl b-galactoside; |
CAS: | 40427-75-6 |
EINECS: | 249-887-8 |
Molecular Formula: | C14H28O6 |
Molecular Weight: | 292.37 |
InChI: | InChI=1/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10?,11-,12+,13?,14-/m1/s1 |
Molecular Structure: |
 |
Properties |
Density: | 1.187 g/cm3 |
Refractive index: | 1.516 |
Appearance: | White Crystalline Solid |
Storage Temperature: | 2-8°C |
Usage: | A nonionic detergent for the solubilization of membrane bound protein |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |