| Identification |
| Name: | Hexanedioic acid, compd. with 2,2',2''-nitrilotris[ethanol] OTHER CA INDEX NAMES: Ethanol, 2,2',2''-nitrilotris-, hexanedioate (salt) |
| Synonyms: | Adipic acid, compound with 2,2,2-nitrilotriethanol |
| CAS: | 29867-73-0 |
| EINECS: | 249-902-8 |
| Molecular Formula: | C6H15NO3.xC6H10O4 |
| Molecular Weight: | 295.3294 |
| InChI: | InChI=1/C6H15NO3.C6H10O4/c8-4-1-7(2-5-9)3-6-10;7-5(8)3-1-2-4-6(9)10/h8-10H,1-6H2;1-4H2,(H,7,8)(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 185°C |
| Safety Data |
| |
 |
