| Identification | |
| Name: | benzeneacetaldehyde, cyclic acetal with glycerol |
| Synonyms: | Benzeneacetaldehyde, cyclic acetal with 1,2,3-propanetriol;5-Hydroxy-2-benzyl-1,3-dioxan;5-Hydroxymethyl-2-benzyl-1,3-dioxolane;Acetaldehyde, phenyl-, cyclic acetal with glycerol;Benzeneacetaldehyde 1,2,3-propanetriol cyclic acetal;Phenylacetaldehyde glyceryl acetal;Benzeneacetaldehyde, cyclic acetal with glycerol;(2-benzyl-1,3-dioxolan-4-yl)methanol |
| CAS: | 29895-73-6 |
| EINECS: | 249-934-2 |
| Molecular Formula: | C11H14O3 |
| Molecular Weight: | 194.2271 |
| InChI: | InChI=1/C11H14O3/c12-7-10-8-13-11(14-10)6-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 156.5°C |
| Boiling Point: | 316.9°C at 760 mmHg |
| Density: | 1.158g/cm3 |
| Refractive index: | 1.537 |
| Flash Point: | 156.5°C |
| Safety Data | |
 |
|
