| Identification | |
| Name: | Benzene,2-fluoro-1-iodo-4-nitro- |
| Synonyms: | 2-Fluoro-1-iodo-4-nitrobenzene;NSC 24643 |
| CAS: | 2996-30-7 |
| Molecular Formula: | C6H3 F I N O2 |
| Molecular Weight: | 267 |
| InChI: | InChI=1/C6H3FINO2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 130.1°C |
| Boiling Point: | 291.5°C at 760 mmHg |
| Density: | 2.093g/cm3 |
| Refractive index: | 1.635 |
| Specification: |
2-fluoro-1-iodo-4-nitro-benzene , with CAS number of 2996-30-7, can be called 2-fluoro-1-iodo-4-nitrobenzene ; benzene, 2-fluoro-1-iodo-4-nitro- ; 3-Fluoro-4-Iodonitrobenzene . |
| Flash Point: | 130.1°C |
| Safety Data | |
 |
|
