| Identification |
| Name: | 1-Propene,1-bromo-2-methyl- (9CI) |
| Synonyms: | Propene,1-bromo-2-methyl- (6CI,7CI,8CI);1-Bromo-2,2-dimethylethylene;1-Bromo-2-methyl-1-propene;1-Bromo-2-methylpropene;1-Bromoisobutene;b,b-Dimethylvinyl bromide;NSC 148224;Isocrotyl bromide;2-Methylpropenyl bromide;Isobutenyl bromide;3-Bromo-2-methyl-2-propene;2-Methyl-1-propenyl bromide; |
| CAS: | 3017-69-4 |
| Molecular Formula: | C4H7Br |
| Molecular Weight: | 135.0024 |
| InChI: | InChI=1/C4H7Br/c1-4(2)3-5/h3H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 3 |
| Refractive index: | n20/D 1.462(lit.) |
| Appearance: | Colorless to Amber MATERIAL MAY DARKEN IN STORAGE WITH NO LOSS OF |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
F: Flammable
Xi: Irritant
|
| |
 |
