| Identification | |
| Name: | 1-Propene,1-chloro-2-methyl- (9CI) |
| Synonyms: | Propene,1-chloro-2-methyl- (6CI,7CI,8CI); 1-Chloro-2-methyl-1-propene;1-Chloro-2-methylpropene; 2,2-Dimethylvinyl chloride; 2-Methyl-1-chloropropene;2-Methyl-1-propenyl chloride; Dimethylvinyl chloride; Isocrotyl chloride; a-Chloroisobutylene; b,b-Dimethylvinyl chloride |
| CAS: | 513-37-1 |
| EINECS: | 208-158-4 |
| Molecular Formula: | C4H7 Cl |
| Molecular Weight: | 90.56 |
| InChI: | InChI=1/C4H7Cl/c1-4(2)3-5/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 2 |
| Flash Point: | °C |
| Boiling Point: | 68.1°Cat760mmHg |
| Density: | 0.911g/cm3 |
| Refractive index: | n20/D 1.424(lit.) |
| Solubility: | SOL IN ACETONE; VERY SOL IN CHLOROFORM; SOL IN ALL PROPORTIONS IN ALCOHOL & ETHER Water solubility = 1000 mg/L [Shiu WY et al; Rev Environ Contam Toxicol 116: 15-187 (1990)] PubMed Abstract |
| Specification: |
1-Chloro-2-methylpropene , its cas register number is 513-37-1. It also can be called DMVC ; 1-Chloro-2-methyl-1-propene ; and Isocrotyl chloride . It is incompatible with strong oxidizing agents and strong bases. |
| Report: |
NTP 10th Report on Carcinogens. NTP Carcinogenesis Studies (gavage); Clear Evidence: mouse, rat NTPTR* National Toxicology Program Technical Report Series. (Research Triangle Park, NC 27709) No. NTP-TR-316 ,1986. . |
| Packinggroup: | II |
| Flash Point: | °C |
| Color: | Clear, colorless liquid LIQUID |
| Safety Data | |
 |
|
