| Identification | |
| Name: | 5H-Dibenz[b,f]azepin-2-ol,5-[3-(dimethylamino)propyl]-10,11-dihydro- |
| Synonyms: | 2-Hydroxyimipramine;G 33679 |
| CAS: | 303-70-8 |
| Molecular Formula: | C19H24 N2 O |
| Molecular Weight: | 296.45 |
| InChI: | InChI=1/C19H24N2O/c1-20(2)12-5-13-21-18-7-4-3-6-15(18)8-9-16-14-17(22)10-11-19(16)21/h3-4,6-7,10-11,14,22H,5,8-9,12-13H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 239.5°C |
| Boiling Point: | 469°Cat760mmHg |
| Density: | 1.107g/cm3 |
| Refractive index: | 1.593 |
| Specification: |
2-Hydroxyimipramine , its cas register number is 303-70-8. It also can be called 2-OH-IP ; 5-(3-(Dimethylamino)propyl)-10,11-dihydro-5H-dibenz(b,f)azepin-2-ol ; 5-(3-(Dimethylamino)propyl)-2-hydroxy-10,11-dihydro-5H-dibenz(b,f)azepine ; 5-21-04-00033 (Beilstein Handbook Reference) ; BRN 1547775 ; G 33679 ; GP 33679 ; Hydroxyimipramine ; 5H-Dibenz(b,f)azepin-2-ol, 10,11-dihydro-5-(3-(dimethylamino)propyl)- . It is a tan solid. |
| Flash Point: | 239.5°C |
| Usage: |
2-Hydroxyimipramine (CAS NO.303-70-8) can be used as a metabolite of Imipramine. |
| Safety Data | |
 |
|
