Identification |
Name: | Boronic acid,B-(3-aminophenyl)- |
Synonyms: | Benzeneboronicacid, m-amino- (6CI,7CI,8CI);Boronic acid, (3-aminophenyl)- (9CI);3-Aminophenyl(dihydroxy)borane;m-Aminobenzeneboronic acid;m-Aminophenylboronicacid; |
CAS: | 30418-59-8 |
EINECS: | 250-189-0 |
Molecular Formula: | C6H8BNO2 |
Molecular Weight: | 136.94 |
InChI: | InChI=1/C6H8BNO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H,8H2 |
Molecular Structure: |
 |
Properties |
Density: | 1.23 g/cm3 |
Appearance: | Light yellow crystalline solid |
Specification: |
The extinguishing agent of 3-Aminophenylboronic acid (CAS No.30418-59-8) are dry powder, foam, sand, carbon dioxide, water mist.
|
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |