| Identification | |
| Name: | 2,6-Diiodo-4-nitrophenol |
| Synonyms: | Disophenol |
| CAS: | 305-85-1 |
| EINECS: | 206-170-4 |
| Molecular Formula: | C6H3I2NO3 |
| Molecular Weight: | 390.9 |
| InChI: | InChI=1/C6H3I2NO3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 2.717 g/cm3 |
| Stability: | Stable. |
| Water Solubility: | very sparingly soluble |
| Solubility: | very sparingly soluble |
| Appearance: | yellow crystalline solid |
| Specification: |
2,6-Diiodo-4-nitrophenol (305-85-1) is a yellow crystalline solid used against hookworm. It is a halogenated and nitrated phenol. Reacts as a weak acid. It is stable and very sparingly soluble in water. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
T:Toxic
Xn:Harmful
|
 |
|
