| Identification | |
| Name: | Homovanillic acid |
| Synonyms: | 4-Hydroxy-3-methoxyphenylacetic acid; HVA; Homovanillic acid 4-Hydroxy-3-methoxyphenylacetic acid; 4-hydroxy-3-methoxyphenyl acetic acid |
| CAS: | 306-08-1 |
| EINECS: | 206-176-7 |
| Molecular Formula: | C9H10O4 |
| Molecular Weight: | 182.17 |
| InChI: | InChI=1/C9H10O4/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4,10H,5H2,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 151.9ºC |
| Boiling Point: | 368.7ºCat760mmHg |
| Density: | 1.307g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble |
| Solubility: | Soluble SOLVENT |
| Appearance: | white to off-white crystalline powder |
| Specification: |
Storage: Keep container in a cool, well-ventilated area. Keep container tightly closed. |
| Biological Activity: | Fluorimetric reagent and major catecholamine metabolite. Used for fluorimetric determination of oxidative enzymes including glucose oxidase. |
| Flash Point: | 151.9ºC |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
