| Identification | |
| Name: | butane-1,4-diol; dimethyl benzene-1,4-dicarboxylate |
| Synonyms: | dimethyl benzene-1,4-dicarboxylate- butane-1,4-diol(1:1);1,4-Butanediol, dimethyl terephthalate polymer;AC1L3PL7;AC1Q5Z6Y;AR-1I5625;Dimethyl terephthalate 1,4-butanediol polymer;butane-1,4-diol; dimethyl benzene-1,4-dicarboxylate;1,4-Benzenedicarboxylic acid, dimethyl ester, 1,4-butanediol polymer;1,4-Benzenedicarboxylic acid, dimethyl ester, polymer with 1,4-butanediol;1,4-Benzenedicarboxylic acid, 1,4-dimethyl ester, polymer with 1,4-butanediol;144854-91-1 |
| CAS: | 30965-26-5 |
| Molecular Formula: | C14H20O6 |
| Molecular Weight: | 284.305 |
| InChI: | InChI=1S/C10H10O4.C4H10O2/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2;5-3-1-2-4-6/h3-6H,1-2H3;5-6H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148°C |
| Boiling Point: | 285°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 148°C |
| Safety Data | |
 |
|
