| Identification | |
| Name: | Benzene, 1,1'-oxybis-,hexachloro deriv. |
| Synonyms: | Phenylether, hexachloro deriv. (8CI); Hexachlorodiphenyl ether |
| CAS: | 31242-93-0 |
| Molecular Formula: | C12H4 Cl6 O |
| Molecular Weight: | 376.86 |
| InChI: | InChI=1S/C12H4Cl6O/c13-5-1-7(15)11(8(16)2-5)19-12-9(17)3-6(14)4-10(12)18/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3077 |
| Boiling Point: | 230~260(1.1kPa) |
| Specification: |
Chlorinated diphenyl oxide , its cas register number is 31242-93-0. It also can be called 1,1'-Oxybisbenzene hexachloro deriv. ; 1,1'-Oxybishexachloro benzene, derivative ; Ether, hexachlorophenyl ; Hxachloro diphenyl oxide ; Heachlorodiphenyl ether ; Hexachlorodiphenyl oxide ; Phenyl ether, hexachloro deriv. ; Trichloro diphenyl ether ; Hexachlorodiphenyloxide ; and Trichloro diphenyl oxide . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Toxic by ingestion. TLV: 0.5
|
 |
|
