| Identification | |
| Name: | 2,4,6-Trifluoronitrobenzene |
| Synonyms: | 1,3,5-Trifluoro-2-nitrobenzene |
| CAS: | 315-14-0 |
| EINECS: | 206-248-8 |
| Molecular Formula: | C6H2F3NO2 |
| Molecular Weight: | 177.08 |
| InChI: | InChI=1/C6H2F3NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2810 |
| Density: | 1.514 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.477 |
| Solubility: | Slightly soluble |
| Appearance: | Liquid. |
| Specification: |
1,3,5-Trifluoro-2-nitrobenzene ,its CAS NO. is 315-14-0,the synonyms is 2,2,6-Trifluoronitrobenzene ; 2,4,6-Trifluoronitrobenzene ; 2-Nitro-1,3,5-trifluorobenzene ; 4-Fluroaniline ; 2,4,6-Trifluoro-1-nitrobenzene . |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
