| Identification |
| Name: | Poly(oxy-1,2-ethanediyl),a,a',a''-1,2,3-propanetriyltris[w-hydroxy- |
| Synonyms: | Glycols,polyethylene, 1,2,3-propanetriyl ether (8CI); AM 30; AM 30 (surfactant); AdekaAM 30; Adeka Carpol TE 100; Blaunon GL 20; Conion RG 120; Daltocel F 526;Ethosperse G 26; Ethoxylated glycerin; Ethoxylated glycerol; Ethylene oxidepolymer ether with glycerol; G 1285; G 450; GE 1000; GE 1000 (polyoxyalkylene);GE 600; GE 935; GL 20; Genapol G 260; Glycereth; Glycereth 12; Glycereth 26;Glycereth 31; Glycereth 6; Glycereth 7; Glycereth-18; Glycereth-9; Glycerolpolyoxyethylene ether; Glycerol-ethylene oxide adduct; Glycerol-polyethyleneglycol adduct; HF 1; Hetoxide G 26; Hetoxide G 7; IP 625; Liponic EG 1; LiponicEG 7; Lupranol VP 9209; Lutron HF 1; Newpol GE 600; Newpol PE 600; Nissan UnioxG 1200; Nissan Uniox G 140; Nissan Uniox G 180; Nissan Uniox G 450; NissanUniox G 750; Oxyethylated glycerol; Poly(ethylene oxide) glyceryl ether;Polyethylene glycol glycerin ether; Polyethylene glycol glycerol ether;Polyethylene glycol glyceryl ether; Polyethylene glycol triether with glycerol;Polyglycol G 300; Polyoxethylene glycerol; Polyoxyethylene glycerin; Polyoxyethyleneglycerin ether; Polyoxyethylene glycerol; Polyoxyethylene glycerol ether; SH-E0100; Sannix GE 200; Sannix GE 600; Texox 440; Uniox G 1200; Uniox G 140; UnioxG 180; Uniox G 450; Uniox G 750; VP 9209; Volpo G 26; Volpo G 31; Voralux HF501; Voranol CP 8000; Witbreak DTG 62; a,a',a''-1,2,3-Propanetriyltris[w-hydroxypoly(oxy-1,2-ethanediyl)];a-Hydro-w-hydroxypoly(oxy-1,2-ethanediyl)ether with 1,2,3-propanetriol |
| CAS: | 31694-55-0 |
| EINECS: | 244-250-0 |
| Molecular Formula: | (C2H4 O)n (C2 H4 O)n (C2 H4 O)n C3 H8 O3 |
| Molecular Weight: | 224.2515 |
| InChI: | InChI=1S/C9H20O6/c10-1-4-13-7-9(15-6-3-12)8-14-5-2-11/h9-12H,1-8H2 |
| Molecular Structure: |
 |
| Properties |
| Refractive index: | n20/D 1.473(lit.) |
| Water Solubility: | H2O: soluble |
| Solubility: | H2O: soluble |
| Appearance: | Clear liquid |
| Usage: | Ethosperse(R) G-26 is a high HLB, ethoxylated, nonionic ether of glycerine. It is used for cosmetics to add body and texture (humectant). It finds an application as tackifier and humectant for adhesives. Product Data Sheet |
| Safety Data |
| |
 |
