| Identification |
| Name: | 2,6-Dichlorophenylacetonitrile |
| Synonyms: | 2,6-Dichlorobenzyl cyanide; 2,6-Dichlorophenylacetic acid nitrile; |
| CAS: | 3215-64-3 |
| EINECS: | 221-730-8 |
| Molecular Formula: | C8H5Cl2N |
| Molecular Weight: | 186.04 |
| InChI: | InChI=1/C8H5Cl2N/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3H,4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3439 |
| Density: | 1.333 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.565 |
| Solubility: | insoluble |
| Appearance: | White to light yellow crystalline powder |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
