Identification |
Name: | 2,6-Dichlorophenylacetonitrile |
Synonyms: | 2,6-Dichlorobenzyl cyanide; 2,6-Dichlorophenylacetic acid nitrile; |
CAS: | 3215-64-3 |
EINECS: | 221-730-8 |
Molecular Formula: | C8H5Cl2N |
Molecular Weight: | 186.04 |
InChI: | InChI=1/C8H5Cl2N/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3H,4H2 |
Molecular Structure: |
 |
Properties |
Transport: | 3439 |
Density: | 1.333 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.565 |
Solubility: | insoluble |
Appearance: | White to light yellow crystalline powder |
Packinggroup: | III |
HS Code: | 29269095 |
Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |