| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 4-methyl- |
| Synonyms: | Nicotinicacid, 4-methyl- (6CI,7CI,8CI);4-Methyl-3-pyridinecarboxylic acid;4-Picoline-3-carboxylic acid;Homonicotinic acid;NSC22592; |
| CAS: | 3222-50-2 |
| Molecular Formula: | C7H7NO2 |
| Molecular Weight: | 137.14 |
| InChI: | InChI=1/C7H7NO2/c1-5-2-3-8-4-6(5)7(9)10/h2-4H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 137.7°C |
| Boiling Point: | 304.1°Cat760mmHg |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.561 |
| Specification: |
3-Pyridinecarboxylicacid, 4-methyl- , its cas register number is 3222-50-2. It also can be called 4-Methylnicotinic acid ; 4-Methyl-3-pyridinecarboxylic acid ; 4-Methylnicotinic acid hydrochloride ;4-Methylpyridine-3-Carboxylic Acid . 3-Pyridinecarboxylicacid, 4-methyl- (CAS NO.3222-50-2) is irritating to eyes, respiratory system and skin. So you should wear suitable protective clothing. |
| Flash Point: | 137.7°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
