| Identification | |
| Name: | 4-Bromo-2-fluoroacetanilide |
| Synonyms: | N-(4-Bromo-2-fluorophenyl)acetamide |
| CAS: | 326-66-9 |
| EINECS: | 206-314-6 |
| Molecular Formula: | C8H7BrFNO |
| Molecular Weight: | 232.05 |
| InChI: | InChI=1/C8H7BrFNO/c1-5(12)11-8-3-2-6(9)4-7(8)10/h2-4H,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 332.9 ºC |
| Boiling Point: | 332.9 ºC |
| Density: | 1.623 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.423 |
| Appearance: | Slightly beige powder. |
| Specification: |
N-(4-Bromo-2-fluorophenyl)acetamide , its CAS NO. is 326-66-9, the synonym is EINECS 206-314-6 . |
| Packinggroup: | III |
| Flash Point: | 332.9 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
