Identification |
Name: | (-)-Di-p-toluoyl-L-tartaric acid |
Synonyms: | (-)-Di-p-toluoyl-(L)-tartaric acid monohydrate anhydrous; (?-O,O-Di-p-toluyl-L-tartaric acid; (-)-DI-O,O'-p-TOLUYL-L-TARTARIC ACID; Di-p-Toluoyl-D-Tartaric acid; DI-P-TOLUOYL-L-TARTARIC ACID; L-DTTA |
CAS: | 32634-66-5 |
EINECS: | 251-131-7 |
Molecular Formula: | C20H18O8 |
Molecular Weight: | 386.36 |
InChI: | InChI=1/C20H18O8/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24) |
Molecular Structure: |
|
Properties |
Density: | 1.371 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Alpha: | -142 o (C=10, ETOH) |
Water Solubility: | soluble |
Solubility: | soluble |
Appearance: | off-white crystalline powder |
HS Code: | 29181300 |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Usage: | Inhibitor of enzyme |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|