| Identification | |
| Name: | Benzene,1,1'-oxybis[4-fluoro- |
| Synonyms: | Ether,bis(p-fluorophenyl) (7CI,8CI); 4,4'-Difluorodiphenyl ether; Bis(4-fluorophenyl)ether; Bis(p-fluorophenyl) ether; NSC 51793 |
| CAS: | 330-93-8 |
| EINECS: | 206-358-6 |
| Molecular Formula: | C12H8 F2 O |
| Molecular Weight: | 206.1881 |
| InChI: | InChI=1S/C12H8F2O/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Refractive index: | n20/D 1.537(lit.) |
| Appearance: | Clear, colorless to pale yellow liquid |
| Specification: |
Bis(4-fluorophenyl)ether (330-93-8) also can be called for benzene, 1,1'-oxybis[4-fluoro- , Dimethylthiomethane ; 1,1'-Oxybis(4-fluorobenzene) ; p-Fluorophenyl ether ,and, 1,1'-Oxybis(4-fluorobenzene) . |
| Safety Data | |
 |
|
