Identification |
Name: | Spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-2',7'-dicarboxylicacid, 4',5',7-tribromo-3',6'-dihydroxy-3-oxo- |
Synonyms: | Spiro[phthalan-1,9'-xanthene]-2',7'-dicarboxylicacid, 4',5',7-tribromo-3',6'-dihydroxy- (8CI); C.I. Solvent Orange 17; D And COrange Number 14; D and C Orange No. 14 |
CAS: | 33014-42-5 |
Molecular Formula: | C22H9 Br3 O9 |
Molecular Weight: | 0 |
InChI: | InChI=1/C22H9Br3O9/c23-11-3-1-2-6-12(11)22(34-21(6)32)9-4-7(19(28)29)15(26)13(24)17(9)33-18-10(22)5-8(20(30)31)16(27)14(18)25/h1-5,26-27H,(H,28,29)(H,30,31) |
Molecular Structure: |
|
Properties |
Flash Point: | 436.7°C |
Boiling Point: | 798.5°C at 760 mmHg |
Density: | 2.47g/cm3 |
Refractive index: | 1.903 |
Flash Point: | 436.7°C |
Safety Data |
|
|