| Identification |
| Name: | Ethanethioic acid,S-(3-methyl-2-buten-1-yl) ester |
| Synonyms: | Aceticacid, thio-, S-(3-methyl-2-butenyl) ester (7CI,8CI); Ethanethioic acid,S-(3-methyl-2-butenyl) ester (9CI) |
| CAS: | 33049-93-3 |
| Molecular Formula: | C7H12 O S |
| Molecular Weight: | 144.23458 |
| InChI: | InChI=1/C7H12OS/c1-6(2)4-5-9-7(3)8/h4H,5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 53.2°C |
| Boiling Point: | 175°Cat760mmHg |
| Density: | 0.97g/cm3 |
| Refractive index: | 1.482 |
| Flash Point: | 53.2°C |
| Usage: | A precursor to 3-Methyl-2-butenyl-1-thiol which is very prone to oxidation to the disulfide. We will provide a detailed procedure for the preparation of the thiol from the thioacetate with spectral data upon request |
| Safety Data |
| |
 |
