| Identification |
| Name: | Hexanoic acid,3-methyl-2-buten-1-yl ester |
| Synonyms: | Hexanoicacid, 3-methyl-2-butenyl ester (9CI);3-Methyl-2-butenyl hexanoate; |
| CAS: | 76649-22-4 |
| EINECS: | 278-515-7 |
| Molecular Formula: | C11H20O2 |
| Molecular Weight: | 184.28 |
| InChI: | InChI=1/C11H20O2/c1-4-5-6-7-11(12)13-9-8-10(2)3/h8H,4-7,9H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.89 g/cm3 |
| Refractive index: | 1.441 |
| Water Solubility: | Practically insoluble to insoluble in water |
| Solubility: | Practically insoluble to insoluble in water |
| Appearance: | Colourless liquid; Mild green fruit aroma |
| Safety Data |
| |
 |
