Identification |
Name: | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one,3',6'-dihydroxy-5-isothiocyanato- |
Synonyms: | Fluorescein,5-isothiocyanato- (8CI);5-Isothiocyanatofluorescein;FITC isomer I;Fluorescein 5-isothiocyanate;Fluoroscein-5-isothiocyanate;5-FITC, luorescein-5-isothiocyanate; |
CAS: | 3326-32-7 |
EINECS: | 222-042-0 |
Molecular Formula: | C21H11NO5S |
Molecular Weight: | 389.38 |
InChI: | InChI=1/C21H11NO5S/c23-12-2-5-15-18(8-12)27-19-9-13(24)3-6-16(19)20(15)14-4-1-11(22-10-28)7-17(14)21(25)26/h1-9,23H,(H,25,26) |
Molecular Structure: |
|
Properties |
Melting Point: | 360 oC |
Density: | 1.54g/cm3 |
Stability: | Stability Stable, but moisture-sensitive. Incompatible with strong oxidizing agents, strong bases, amines, acids. |
Refractive index: | 1.715 |
Water Solubility: | practically insoluble |
Solubility: | practically insoluble |
Appearance: | powder |
Sensitive: | Moisture Sensitive |
Usage: | Fluorescent labeling reagent for proteins. Used in the fluorescent antibody technique for rapid identification of pathogens |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|