Identification |
Name: | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one,3',6'-dihydroxy-5-nitro- |
Synonyms: | Fluorescein,5-nitro- (6CI,7CI,8CI); 5-Nitrofluorescein |
CAS: | 3326-35-0 |
Molecular Formula: | C20H11 N O7 |
Molecular Weight: | 377.3 |
InChI: | InChI=1/C20H11NO7/c22-11-2-5-15-17(8-11)27-18-9-12(23)3-6-16(18)20(15)14-4-1-10(21(25)26)7-13(14)19(24)28-20/h1-9,15,23H |
Molecular Structure: |
 |
Properties |
Flash Point: | 372.3°C |
Boiling Point: | 692°Cat760mmHg |
Density: | 1.72g/cm3 |
Refractive index: | 1.764 |
Flash Point: | 372.3°C |
Usage: | Fluorescent labeling reagent for proteins. Used in the fluorescent antibody technique for rapid identification of pathogens |
Safety Data |
|
 |