Identification |
Name: | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one,3',6'-dihydroxy-6-nitro- |
Synonyms: | Fluorescein,6-nitro- (6CI,7CI,8CI); 6-Nitrofluorescein |
CAS: | 27402-68-2 |
Molecular Formula: | C20H11 N O7 |
Molecular Weight: | 377.3 |
InChI: | InChI=1/C20H11NO7/c22-11-2-5-14-17(8-11)27-18-9-12(23)3-6-15(18)20(14)16-7-10(21(25)26)1-4-13(16)19(24)28-20/h1-9,22-23H |
Molecular Structure: |
![(C20H11NO7) Fluorescein,6-nitro- (6CI,7CI,8CI); 6-Nitrofluorescein](https://img1.guidechem.com/chem/e/dict/216/27402-68-2.jpg) |
Properties |
Flash Point: | 379°C |
Boiling Point: | 703°C at 760 mmHg |
Density: | 1.72g/cm3 |
Refractive index: | 1.807 |
Flash Point: | 379°C |
Usage: | Fluorescent labeling reagent for proteins. Used in the fluorescent antibody technique for rapid identification of pathogens |
Safety Data |
|
![](/images/detail_15.png) |