Identification |
Name: | 1,3-Benzenedicarboxylicacid, 1,3-bis(2-butoxy-1-methyl-2-oxoethyl) ester |
Synonyms: | Isophthalicacid, diester with butyl lactate (7CI,8CI); NSC 78758 |
CAS: | 3353-37-5 |
Molecular Formula: | C22H30 O8 |
Molecular Weight: | 422.4688 |
InChI: | InChI=1/C22H30O8/c1-5-7-12-27-19(23)15(3)29-21(25)17-10-9-11-18(14-17)22(26)30-16(4)20(24)28-13-8-6-2/h9-11,14-16H,5-8,12-13H2,1-4H3 |
Molecular Structure: |
![(C22H30O8) Isophthalicacid, diester with butyl lactate (7CI,8CI); NSC 78758](https://img1.guidechem.com/chem/e/dict/63/3353-37-5.jpg) |
Properties |
Flash Point: | 222.3°C |
Boiling Point: | 519.2°Cat760mmHg |
Density: | 1.138g/cm3 |
Refractive index: | 1.498 |
Flash Point: | 222.3°C |
Safety Data |
|
![](/images/detail_15.png) |