| Identification | |
| Name: | Benzene,1-bromo-3-(methylthio)- |
| Synonyms: | Sulfide,m-bromophenyl methyl (6CI,7CI,8CI);1-Bromo-3-(methylsulfanyl)benzene;1-Bromo-3-(methylthio)benzene;3-(Methylthio)bromobenzene;3-Bromophenyl methylsulfide;3-Bromothioanisole;Methyl m-bromophenyl sulfide;m-Bromo(methylthio)benzene;m-Bromophenyl methyl sulfide;m-Bromothioanisole; |
| CAS: | 33733-73-2 |
| Molecular Formula: | C7H7BrS |
| Molecular Weight: | 203.1 |
| InChI: | InChI=1/C7H7BrS/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.51 |
| Refractive index: | 1.628 |
| Appearance: | Pale-Yellow Liquid |
| Specification: |
3-Bromothioanisole , with CAS number of 33733-73-2, can be called 1-Bromo-3-(methylsulfanyl)benzene ; 1-Bromo-3-(methylthio)benzene ; 3-(Methylthio)bromobenzene ; 3-Bromophenyl methylsulfide ; Methyl m-bromophenyl sulfide ; m-Bromo(methylthio)benzene ; m-Bromophenyl methyl sulfide ; m-Bromothioanisole . It is a pale-yellow liquid. |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
