| Identification | |
| Name: | METHAQUALONE HYDROCHLORIDE |
| Synonyms: | 2-methyl-3-(o-tolyl)-4-quinazolonehydrochloride;2-methyl-3-o-tolyl-4(3h)-quinazolinonehydrochloride;2-methyl-3-o-tolyl-4(3h)-quinazolinonhydrochloride;2-methyl-3-tolylchinazolon-4hydrochloride;2-metil-3-(o-tolil)-4-chinazolonechloridrato;melsedin;methylquinazolonehydrochloride;mtqhydrochloride |
| CAS: | 340-56-7 |
| EINECS: | 206-431-2 |
| Molecular Formula: | C16H14N2O•ClH |
| Molecular Weight: | 286.78 |
| InChI: | InChI=1/C16H14N2O.ClH/c1-11-7-3-6-10-15(11)18-12(2)17-14-9-5-4-8-13(14)16(18)19;/h3-10H,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 120 DEG C |
| Flash Point: | 11 °C |
| Boiling Point: | 406.9°C at 760 mmHg |
| Solubility: | PRACTICALLY INSOL IN WATER Soluble 1 in 12 parts of alcohol, 1 in 1 part of chloroform, and 1 in 50 parts of ether. |
| Packinggroup: | III |
| Flash Point: | 11 °C |
| Storage Temperature: | 2-8°C |
| Color: | CRYSTALS White or almost white, crystalline powder. |
| Safety Data | |
| Hazard Symbols | |
 |
|
