| Identification | |
| Name: | DL-1,4-Dithiothreitol |
| Synonyms: | 2,3-Butanediol,1,4-dimercapto-, (R*,R*)-;Threitol, 1,4-dithio- (7CI,8CI);1,4-Dithio-DL-threitol;1,4-Dithiothreitol;Cleland's reagent;DL-1,4-Dimercapto-2,3-dihydroxybutane;Dithiothreitol;DTT (threitol derivative);Reagents, Cleland's;Sputolysin;WR 34678;rac-Dithiothreitol;threo-1,4-Dimercapto-2,3-butanediol;threo-2,3-Dihydroxy-1,4-butanedithiol;threo-2,3-Dihydroxy-1,4-dithiolbutane;2,3-Butanediol,1,4-dimercapto-, (2R,3R)-rel-; |
| CAS: | 3483-12-3 |
| EINECS: | 222-468-7 |
| Molecular Formula: | C4H10O2S2 |
| Molecular Weight: | 154.25 |
| InChI: | InChI=1/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.302g/cm3 |
| Stability: | Stability Stable, but heat sensitive. Incompatible with strong oxidizing agents. Keep frozen at -20 to -10 C. |
| Water Solubility: | freely soluble |
| Solubility: | freely soluble |
| Appearance: | White solid |
| Specification: |
?Dithiothreitol (CAS NO.3483-12-3), its Synonyms are (R*,R*)-(+-)-1,4-Dimercapto-2,3-butanediol ; 1,4-Dithiothreitol ; 2,3-Butanediol, 1,4-dimercapto-, DL-threo- ; Cleland reagent ; Cleland's reagent ; D-1,4-Dithiothreitol ; D-threo-1,4-Dimercapto-2,3-butanediol ; DL-threo-1,4-Dimercapto-2,3-butanediol ; Sputolysin ; Threitol, 1,4-dithio- ; (R*,R*)-(1)-1,4-Dimercaptobutane-2,3-diol ; (R*,R*)-1,4-Dimercaptobutane-2,3-diol ; 2,3-Butanediol, 1,4-dimercapto-, (2R,3R)-rel- ; 2,3-Butanediol, 1,4-dimercapto-, (R*,R*)- (+-)- (9CI) ; 2,3-Butanediol, 1,4-dimercapto-, (theta,theta)-(+/-)- ; 2,3-Butanediol, 1,4-dimercapto-, D-threo- .?Due to air oxidation, Dithiothreitol is a relatively unstable compound whose useful life can be extended by refrigeration and handling in an inert atmosphere. Since protonated sulfurs have lowered nucleophilicities,?it becomes less potent as the pH lowers. Tris(2-carboxyethyl)phosphine HCl (TCEP hydrochloride) is an alternative which is more stable and works even at low pH. |
| Biological Activity: | Reagent for maintaining SH groups in the reduced state. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
