| Identification | |
| Name: | Carbinoxamine maleate |
| CAS: | 3505-38-2 |
| EINECS: | 222-498-0 |
| Molecular Formula: | C16H19ClN2O.C4H4O4 |
| Molecular Weight: | 406.86 |
| InChI: | InChI=1/C16H19ClN2O.C4H4O4/c1-19(2)11-12-20-16(15-5-3-4-10-18-15)13-6-8-14(17)9-7-13;5-3(6)1-2-4(7)8/h3-10,16H,11-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| Molecular Structure: | ![(C16H19ClN2O.C4H4O4) 2-[p-Chloro-α-[2-(dimethylamino)ethoxy]benzyl]pyridine bimaleate;Lergefin;N-[2-[(4-Chlorophenyl)(2-...](https://img.guidechem.com/casimg/3505-38-2.gif) |
| Properties | |
| Transport: | 3249 |
| Melting Point: | 116-1180C |
| Density: | g/cm3 |
| Appearance: | Off-white solid |
| Specification: |
Carbinoxamine maleate ,its cas register number is 3505-38-2.It also can be called (2Z)-But-2-endisäure--2-[(4-chlorphenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamin(1:1) ; 2-[(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine (2Z)-but-2-enedioate ; Ethanamine, 2-[(4-chlorophenyl)-2-pyridinylmethoxy]-N,N-dimethyl-, (2Z)-2-butenedioate (1:1) ; Acide (2Z)-but-2-ènedioïque - 2-[(4-chlorophényl)(pyridin-2-yl)méthoxy]-N,N-diméthyléthanamine (1:1) ; N-[2-[(4-Chlorophenyl)(2-pyridinyl)methoxy]ethyl]-N,N-dimethylamine maleate salt and Carbinoxamine maleate salt . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Usage: |
Carbinoxamine maleate (CAS NO.3505-38-2) has been used for analgesic and anti-inflammatory compound. |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
