| Identification |
| Name: | 4-Fluorobenzyl chloride |
| Synonyms: | alpha-Chloro-4-fluorotoluene; 1-(chloromethyl)-4-fluorobenzene; 1-(chloromethyl)-4-fluoro benzene; alpha-Chloro-p-fluorotoluene |
| CAS: | 352-11-4 |
| EINECS: | 206-516-4 |
| Molecular Formula: | C7H6ClF |
| Molecular Weight: | 144.58 |
| InChI: | InChI=1/C7H6ClF/c8-5-6-1-3-7(9)4-2-6/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 8/PG 2 |
| Density: | 1.207 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.512-1.514 |
| Solubility: | Insoluble |
| Appearance: | clear, colorless liquid |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
