| Identification |
| Name: | 4-fluorobenzyl bromide |
| Synonyms: | alpha-Bromo-4-fluorotoluene; 4-fluoro(bromomethyl)benzene; 1-(Bromomethyl)-4-fluorobenzene |
| CAS: | 459-46-1 |
| EINECS: | 207-291-5 |
| Molecular Formula: | C7H6BrF |
| Molecular Weight: | 189.03 |
| InChI: | InChI=1/C7H6BrF/c8-5-6-1-3-7(9)4-2-6/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 1.517 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Reacts with water to form toxic fumes. |
| Refractive index: | 1.5464-1.5484 |
| Appearance: | Colorless to light yellow liqui |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
