| Identification | |
| Name: | Benzene,1,1'-ethylidenebis[4-chloro- |
| Synonyms: | Ethane,1,1-bis(p-chlorophenyl)- (6CI,7CI,8CI); 1,1-Bis(4-chlorophenyl)ethane;1,1-Bis(p-chlorophenyl)ethane; 1,1'-(Ethylidene)bis[4-chlorobenzene]; DCE;DDNS; DIM; Dimic; K 3926 |
| CAS: | 3547-04-4 |
| Molecular Formula: | C14H12 Cl2 |
| Molecular Weight: | 251.16 |
| InChI: | InChI=1/C14H12Cl2/c1-10(11-2-6-13(15)7-3-11)12-4-8-14(16)9-5-12/h2-10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.6°C |
| Boiling Point: | 332.5°Cat760mmHg |
| Density: | 1.195g/cm3 |
| Refractive index: | 1.581 |
| Specification: |
2,2-Bis(p-chlorophenyl)ethane ,its cas register number is 3547-04-4. It also can be called Bis(p-chlorophenyl)ethane ; Benzene, 1,1'-ethylidenebis(4-chloro- ;and p,p'-Dichlorodiphenyl ethane . 2,2-Bis(p-chlorophenyl)ethane (CAS NO.3547-04-4) arises by dehydrochlorination of DDT, and is incompatible with strong oxidizing and reducing agents, also incompatible with many amines, and azo/diazo compounds, nitrides, with alkali metals, and with epoxides. |
| Flash Point: | 143.6°C |
| Safety Data | |
 |
|
