| Identification | |
| Name: | Benzene,1,1'-ethylidenebis- |
| Synonyms: | Ethane,1,1-diphenyl- (6CI,8CI); Ethane, as-diphenyl- (3CI); 1,1-Diphenylethane;Methyldiphenylmethane; NSC 33534; Pabsol 300 |
| CAS: | 612-00-0 |
| Molecular Formula: | C14H14 |
| Molecular Weight: | 182.26096 |
| InChI: | InChI=1S/C14H14/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -18 ºC |
| Density: | 0.979 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.5756 (20 C) |
| Water Solubility: | 5040 mg/L at 25ºC |
| Solubility: | 5040 mg/L at 25ºC |
| Appearance: | clear low viscosity liquid |
| Specification: |
Removal in wastewater treatment of 1,1-Diphenylethane (612-00-0): |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
 |
|
