| Identification | |
| Name: | Pyrimidine,2,4-dimethoxy- |
| Synonyms: | 2,4-Di-O-methyluracil; |
| CAS: | 3551-55-1 |
| Molecular Formula: | C6H8N2O2 |
| Molecular Weight: | 140.14 |
| InChI: | InChI=1/C6H8N2O2/c1-9-5-3-4-7-6(8-5)10-2/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 88.2°C |
| Density: | 1.1501 |
| Refractive index: | 1.5-1.502 |
| Appearance: | Clear colorless to light brown liquid |
| Specification: |
pyrimidine, 2,4-dimethoxy- , with CAS number of 3551-55-1, can be called 2,4-Dimethoxypyrimidin ; 2,4-Dimethoxypyrimidine . |
| Flash Point: | 88.2°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
