| Identification | |
| Name: | Pentanoic acid,(3Z)-3-hexen-1-yl ester |
| Synonyms: | Pentanoicacid, (3Z)-3-hexenyl ester (9CI); Pentanoic acid, 3-hexenyl ester, (Z)-;Z-3-Hexenyl valerate; cis-3-Hexenyl pentanoate; cis-3-Hexenyl valerate;cis-Hex-3-en-1-yl pentanoate |
| CAS: | 35852-46-1 |
| EINECS: | 252-761-5 |
| Molecular Formula: | C11H20 O2 |
| Molecular Weight: | 184.31 |
| InChI: | InChI=1/C11H20O2/c1-3-5-7-8-10-13-11(12)9-6-4-2/h5,7H,3-4,6,8-10H2,1-2H3/b7-5- |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.889 g/cm3 |
| Refractive index: | 1.442 |
| Water Solubility: | insoluble in water; soluble in fats |
| Solubility: | insoluble in water; soluble in fats |
| Appearance: | Colorless to light yellow liquid. Colourless liquid; fruity, ripe apple or pear-like aroma |
| Specification: |
cis-3-Hexenyl valerate (35852-46-1) also can be called (Z)-3-Hexen-1-ol, pentanoate ; (E)-Hex-3-enyl valerate ; Neopentyl ethylphosphonofluoridoate ; cis-3-Hexenyl pentanoate ; (E)-3-Hexen-1-ol, pentanoate ; (Z)-Hex-3-enyl valerate ; (Z)-3-Hexenyl valerate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
