| Identification | |
| Name: | Hordenine sulfate |
| Synonyms: | Anhaline sulfate; 4-[2-(Dimethylamino)ethyl]phenol sulphate (2:1); |
| CAS: | 3595-05-9 |
| EINECS: | 208-710-4 |
| Molecular Formula: | C10H15NO |
| Molecular Weight: | 165.2322 |
| InChI: | InChI=1S/C10H15NO/c1-11(2)8-7-9-3-5-10(12)6-4-9/h3-6,12H,7-8H2,1-2H3 |
| Molecular Structure: | ![(C10H15NO) Anhaline sulfate; 4-[2-(Dimethylamino)ethyl]phenol sulphate (2:1);](https://img.guidechem.com/cas/gif/3595-05-9.gif) |
| Properties | |
| Density: | 1.026 g/cm3 |
| Specification: |
Hordenine sulfate , with CAS number of 3595-05-9, can be called Anhaline sulfate; 4-[2-(Dimethylamino)ethyl]phenol sulphate (2:1) . Hordenine sulfate (CAS NO.3595-05-9) is a phenylethylamine alkaloid with antibacterial and antibiotic properties. It stimulates the release of norepinephrine in mammals. It has been shown that hordenine, N, N-Dimethyl-hydroxyphenylethylamine, exhibits an inhibitory action against at least 18 strains of penicillin resistant Staphylococcus bacteria. |
| Safety Data | |
 |
|
