| Identification | |
| Name: | Hordenine |
| Synonyms: | Eremursine(7CI);Phenol, p-[2-(dimethylamino)ethyl]- (8CI);Anhalin;Anhaline;Cactine;Hordenin;N,N-Dimethyl-4-hydroxy-b-phenethylamine;N,N-Dimethyl-p-hydroxyphenethylamine;N,N-Dimethyltyramine;Ordenina;Peyocactine;p-Hydroxy-N,N-dimethylphenethylamine;p-[2-(Dimethylamino)ethyl]phenol; |
| CAS: | 539-15-1 |
| EINECS: | 208-710-4 |
| Molecular Formula: | C10H15NO |
| Molecular Weight: | 165.23 |
| InChI: | InChI=1/C10H15NO/c1-11(2)8-7-9-3-5-10(12)6-4-9/h3-6,12H,7-8H2,1-2H3 |
| Molecular Structure: | ![(C10H15NO) Eremursine(7CI);Phenol, p-[2-(dimethylamino)ethyl]- (8CI);Anhalin;Anhaline;Cactine;Hordenin;N,N-Dime...](https://img1.guidechem.com/chem/e/dict/1/539-15-1.jpg) |
| Properties | |
| Density: | 1.026g/cm3 |
| Refractive index: | 1.542 |
| Appearance: | White crystal |
| Specification: |
4-(2-Dimethylaminoethyl)phenol , its CAS NO. is 539-15-1, the synonyms are Hordenine ; p-(2-Dimethylaminoethyl)phenol ; Phenol, p-[2-(dimethylamino)ethyl]- . |
| Usage: | A phenethylamine alkaloid with antibacterial and antibiotic properties found mainly in plants from the cactaceae family. It showed effects similar to Cytosine (C998950) and acted as a depressant on the central nervous system (CNS) during animal testing. |
| Safety Data | |
 |
|
