| Identification |
| Name: | 5-Methylchrysene |
| Synonyms: | 5-Methylchrysene;NSC 407620 |
| CAS: | 3697-24-3 |
| Molecular Formula: | C19H14 |
| Molecular Weight: | 242.33 |
| InChI: | InChI=1/C19H14/c1-13-12-15-7-3-4-8-16(15)18-11-10-14-6-2-5-9-17(14)19(13)18/h2-12H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 117.5 deg C |
| Flash Point: | 217.8°C |
| Boiling Point: | 449.4°C at 760 mmHg |
| Density: | 1.164g/cm3 |
| Refractive index: | 1.748 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Suspected carcinogen. Toxicity data (The meaning of any toxicological abbreviations which |
| Solubility: | |
| Flash Point: | 217.8°C |
| Storage Temperature: | 2-8°C |
| Color: | Needles (recyrstallized from benzene/ethanol) with a brilliant bluish-violet fluorescence in ultraviolet light |
| Safety Data |
| |
 |
