| Identification | |
| Name: | 6-Fluoro-5-methylchrysene |
| Synonyms: | 6-Fluoro-5-methylchrysene |
| CAS: | 64977-46-4 |
| Molecular Formula: | C19H13F |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C19H13F/c1-12-18-14-7-3-2-6-13(14)10-11-16(18)15-8-4-5-9-17(15)19(12)20/h2-11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 199.2°C |
| Boiling Point: | 451.6°C at 760 mmHg |
| Density: | 1.226g/cm3 |
| Refractive index: | 1.728 |
| Specification: |
6-Fluoro-5-methylchrysene , its cas register number is 64977-46-4. It also can be called BRN 2532049 ; Chrysene, 6-fluoro-5-methyl- . When 6-Fluoro-5-methylchrysene (CAS NO.64977-46-4) is heated to decomposition, it emits toxic fumes of F−. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 199.2°C |
| Safety Data | |
 |
|
