| Identification | |
| Name: | Cyclopropanamine,2-phenyl-, (1S,2R)- |
| Synonyms: | Cyclopropanamine,2-phenyl-, (1S-trans)-; ((1S,2R)-2-Phenylcyclopropyl)amine;(+)-Tranylcypromine; (+)-trans-2-Phenylcyclopropylamine;(1S,2R)-2-Phenylcyclopropanamine; (1S,2R)-Tranylcypromine;(1S-trans)-2-Phenylcyclopropylamine; 1-(S)-Amino-2-(R)-phenylcyclopropane;d-Tranylcypromine |
| CAS: | 3721-28-6 |
| Molecular Formula: | C9H11 N |
| Molecular Weight: | 133.21 |
| InChI: | InChI=1S/C9H11N/c10-9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6,10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 90.8°C |
| Boiling Point: | 218.3°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
trans-2-Phenylcyclopropylamine (CAS NO.3721-28-6) was found to be both an inhibitor and a substrate of lysyl oxidase, the enzyme which oxidizes peptidyl lysine in elastin and collagen to initiate cross-linking in these proteins. |
| Flash Point: | 90.8°C |
| Color: | Liquid |
| Safety Data | |
 |
|
