Identification |
Name: | Ethyl acrylate, methacrylic acid polymer, ammonium salt |
Synonyms: | 2-Propenoic acid, 2-methyl-, polymer with ethyl 2-propenoate, ammonium salt |
CAS: | 37624-87-6 |
Molecular Formula: | C9H16NO4- |
Molecular Weight: | 0 |
InChI: | InChI=1S/C5H8O2.C4H6O2.H2N/c1-3-5(6)7-4-2;1-3(2)4(5)6;/h3H,1,4H2,2H3;1H2,2H3,(H,5,6);1H2/q;;-1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 15.6°C |
Boiling Point: | 99.5°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 15.6°C |
Safety Data |
|
 |