| Identification | |
| Name: | Phenol,2-amino-5-bromo- |
| Synonyms: | 2-Amino-5-bromophenol;4-Bromo-2-hydroxyaniline; |
| CAS: | 38191-34-3 |
| Molecular Formula: | C6H6BrNO |
| Molecular Weight: | 188.02 |
| InChI: | InChI=1/C6H6BrNO/c7-4-1-2-5(8)6(9)3-4/h1-3,9H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 114.096°C |
| Boiling Point: | 265.046°C at 760 mmHg |
| Density: | 1.768 g/cm3 |
| Refractive index: | 1.677 |
| Appearance: | white to light yellow solid |
| Specification: |
2-Amino-5-bromophenol (CAS NO.38191-34-3) is also named as 2-Amino-5-brombenzolol ; Phenol, 2-amino-5-bromo- . It is white to light yellow solid. |
| Flash Point: | 114.096°C |
| Safety Data | |
 |
|
