| Identification | |
| Name: | Butanoic acid,4-(butylnitrosoamino)-3-hydroxy- |
| Synonyms: | Butyl(3-carboxy-2-hydroxypropyl)nitrosamine |
| CAS: | 38252-75-4 |
| Molecular Formula: | C8H16 N2 O4 |
| Molecular Weight: | 204.26 |
| InChI: | InChI=1/C8H16N2O4/c1-2-3-4-10(9-14)6-7(11)5-8(12)13/h7,11H,2-6H2,1H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 220°C |
| Boiling Point: | 440.2°Cat760mmHg |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.513 |
| Specification: |
N-Butyl-N-(2-hydroxy-3-carboxypropyl)nitrosamine , its cas register number is 38252-75-4. It also can be called BRN 2264105 . When heated to decomposition it emits toxic fumes of NOx. |
| Flash Point: | 220°C |
| Safety Data | |
 |
|
