| Identification | |
| Name: | 2-Butanol,4-(butylnitrosoamino)- |
| Synonyms: | N-Butyl-N-(3-hydroxybutyl)nitrosamine;N-Nitroso-N-(3-hydroxybutyl)butylamine |
| CAS: | 40911-07-7 |
| Molecular Formula: | C8H18 N2 O2 |
| Molecular Weight: | 174.28 |
| InChI: | InChI=1/C8H18N2O2/c1-3-4-6-10(9-12)7-5-8(2)11/h8,11H,3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.6°C |
| Boiling Point: | 318.7°C at 760 mmHg |
| Density: | 1.02g/cm3 |
| Refractive index: | 1.475 |
| Specification: |
N-Butyl-N-(3-hydroxybutyl)nitrosamine , its cas register number is 40911-07-7. It also can be called BRN 2244580 ; 2-Butanol, 4-(butylnitrosoamino)- .When heated to decomposition it emits toxic fumes of NOx. |
| Flash Point: | 146.6°C |
| Safety Data | |
 |
|
