| Identification | |
| Name: | Ethanol,2-(butylnitrosoamino)- |
| Synonyms: | Ethanol,2-(butylnitrosamino)- (6CI); Butyl(2-hydroxyethyl)nitrosamine |
| CAS: | 51938-14-8 |
| Molecular Formula: | C6H14 N2 O2 |
| Molecular Weight: | 146.22 |
| InChI: | InChI=1/C6H14N2O2/c1-2-3-4-8(7-10)5-6-9/h9H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 128.8°C |
| Boiling Point: | 289.3°C at 760 mmHg |
| Density: | 1.05g/cm3 |
| Refractive index: | 1.472 |
| Specification: |
The extinguishing agent of Butyl(2-hydroxyethyl)nitrosoamine (CAS NO.51938-14-8) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 128.8°C |
| Safety Data | |
 |
|
