| Identification | |
| Name: | Cyanamide,N-ethyl-N-nitroso- |
| Synonyms: | Cyanamide,ethylnitroso- (9CI); Ethylnitrosocyanamide |
| CAS: | 38434-77-4 |
| Molecular Formula: | C3H5 N3 O |
| Molecular Weight: | 99.11 |
| InChI: | InChI=1/C3H5N3O/c1-2-6(3-4)5-7/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 19°C |
| Boiling Point: | 107.7°Cat760mmHg |
| Density: | 1.11g/cm3 |
| Refractive index: | 1.494 |
| Report: |
EPA Genetic Toxicology Program. Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 19°C |
| Safety Data | |
 |
|
