Identification |
Name: | Cyanamide,N-ethyl-N-nitroso- |
Synonyms: | Cyanamide,ethylnitroso- (9CI); Ethylnitrosocyanamide |
CAS: | 38434-77-4 |
Molecular Formula: | C3H5 N3 O |
Molecular Weight: | 99.11 |
InChI: | InChI=1/C3H5N3O/c1-2-6(3-4)5-7/h2H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 19°C |
Boiling Point: | 107.7°Cat760mmHg |
Density: | 1.11g/cm3 |
Refractive index: | 1.494 |
Report: |
EPA Genetic Toxicology Program. Cyanide and its compounds are on the Community Right-To-Know List.
|
Flash Point: | 19°C |
Safety Data |
|
 |