| Identification |
| Name: | 2-Thiopheneacetyl chloride |
| Synonyms: | 2-Thienylacetyl chloride;2-thiophen-2-ylacetyl chloride;Thiophene-2-acetyl chloride;2-Thiopheneacetyl chloride (TAC);2-Thiopheneacetylchloride;2-Thiophene acetyl chloride; |
| CAS: | 39098-97-0 |
| EINECS: | 254-290-0 |
| Molecular Formula: | C6H5ClOS |
| Molecular Weight: | 160.62 |
| InChI: | InChI=1/C6H5ClOS/c7-6(8)4-5-2-1-3-9-5/h1-3H,4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 1.303 |
| Stability: | Stable under normal temperatures and pressures. May decompose on exposure to moist air or water. Moisture sensitive. |
| Refractive index: | 1.55 |
| Appearance: | clear brown liquid |
| Packinggroup: | III |
| HS Code: | 29349990 |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
